| Identification | |
| Name: | 2-dimethylaminoethyl 2-methylprop-2-enoate; methyl 2-methylprop-2-enoate |
| Synonyms: | AC1MIVM6;Dimethylaminoethyl methacrylate-methylmethacrylate copolymer;2-dimethylaminoethyl 2-methylprop-2-enoate; methyl 2-methylprop-2-enoate;2-Methyl-2-propenoic acid, 2-(dimethylamino)ethyl ester, polymer with 2-methyl-2-propenoic acid, methyl ester;2-Propenoic acid, 2-methyl-, 2-(dimethylamino)ethyl ester, polymer with methyl 2-methyl-2-propenoate;26222-42-4;288583-91-5;288584-12-3 |
| CAS: | 288583-91-5 |
| Molecular Formula: | C13H23NO4 |
| Molecular Weight: | 257.32602 |
| InChI: | InChI=1S/C8H15NO2.C5H8O2/c1-7(2)8(10)11-6-5-9(3)4;1-4(2)5(6)7-3/h1,5-6H2,2-4H3;1H2,2-3H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 70.6°C |
| Boiling Point: | 187°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 70.6°C |
| Safety Data | |
 |
|
