Identification |
Name: | 2-dimethylaminoethyl 2-methylprop-2-enoate; ethene |
Synonyms: | 2-Propenoic acid, 2-methyl-, 2-(dimethylamino)ethyl ester, polymer with ethene;25134-54-7;Sumiepoch F 522;AC1L51LC;DA 1701;DA 3023;DA 3031;2-dimethylaminoethyl 2-methylprop-2-enoate; ethene |
CAS: | 91728-24-4 |
Molecular Formula: | C10H19NO2 |
Molecular Weight: | 185.26336 |
InChI: | InChI=1S/C8H15NO2.C2H4/c1-7(2)8(10)11-6-5-9(3)4;1-2/h1,5-6H2,2-4H3;1-2H2 |
Molecular Structure: |
![(C10H19NO2) 2-Propenoic acid, 2-methyl-, 2-(dimethylamino)ethyl ester, polymer with ethene;25134-54-7;Sumiepoch ...](https://img1.guidechem.com/structure/image/91728-24-4.png) |
Properties |
Flash Point: | 70.6°C |
Boiling Point: | 187°Cat760mmHg |
Density: | g/cm3 |
Flash Point: | 70.6°C |
Safety Data |
|
![](/images/detail_15.png) |