| Identification |
| Name: | DL-Kynurenine |
| Synonyms: | Alanine,3-anthraniloyl- (8CI);3-Anthraniloylalanine;Kynurenin;Kynurenine; |
| CAS: | 343-65-7 |
| EINECS: | 206-445-9 |
| Molecular Formula: | C10H12N2O3 |
| Molecular Weight: | 208.21 |
| InChI: | InChI=1/C10H12N2O3/c11-7-4-2-1-3-6(7)9(13)5-8(12)10(14)15/h1-4,8H,5,11-12H2,(H,14,15) |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | ~235 °C (dec.)
|
| Flash Point: | 236°C |
| Boiling Point: | 466.6°Cat760mmHg |
| Density: | 1.343g/cm3 |
| Refractive index: | 1.625 |
| Flash Point: | 236°C |
| Usage: | A tryptophan metabolite, is a precursor of kynurenic acid, which is an antagonist of N-methyl-aspartate receptor. An amino acid produced in the body from tryptophan |
| Safety Data |
| |
 |
