| Identification | |
| Name: | DL-Adrenalin |
| Synonyms: | 1-(3,4-Dihydroxyphenyl)-2-(methylamino)ethanol; 3,4-Dihydroxy-1-[1-hydroxy-2-(methylamino)-ethyl]benzene; 4-[1-Hydroxy-2-(methylamino)ethyl]-1,2-benzenediol; DL-Epinephrine; DL-Adrenaline |
| CAS: | 329-65-7 |
| EINECS: | 206-347-6 |
| Molecular Formula: | C9H13NO3 |
| Molecular Weight: | 183.21 |
| InChI: | InChI=1/C9H13NO3/c1-10-5-9(13)6-2-3-7(11)8(12)4-6/h2-4,9-13H,5H2,1H3 |
| Molecular Structure: | ![(C9H13NO3) 1-(3,4-Dihydroxyphenyl)-2-(methylamino)ethanol; 3,4-Dihydroxy-1-[1-hydroxy-2-(methylamino)-ethyl]ben...](https://img.guidechem.com/casimg/329-65-7.gif) |
| Properties | |
| Transport: | UN 2811 |
| Density: | 1.283 g/cm3 |
| Stability: | No data. |
| Water Solubility: | Sparingly soluble |
| Solubility: | slightly water soluble |
| Appearance: | odorless light brown or nearly white crystals |
| Specification: |
DL-Adrenalin , its cas register number is 329-65-7. It also can be called 1-(3,4-Dihydroxyphenyl)-2-(methylamino)ethanol ; (+/-)-Adrenaline ; (+/-)-Epinephrine ; 1,2-Benzenediol, 4-(1-hydroxy-2-(methylamino)ethyl)-, (+/-) ; 4-(1-Hydroxy-2-methylaminoethyl)benzene-1,2-diol ; Benzyl alcohol, 3,4-dihydroxy-alpha-((methylamino)methyl)-, (+/-) .It is a odorless light brown or nearly white crystals and slightly water soluble . |
| Packinggroup: | III |
| Storage Temperature: | 2-8°C |
| Usage: | Medication. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
