| Identification | |
| Name: | p-Fluorotoluene |
| Synonyms: | Fluorotoluene3; 4-Fouoromethylbenzene; Fluorotoluenecolorlessliq; 4-Fluorotoluene; Para-Fluorotoluene |
| CAS: | 352-32-9 |
| EINECS: | 206-520-6 |
| Molecular Formula: | C7H7F |
| Molecular Weight: | 110.13 |
| InChI: | InChI=1/C7H7F/c1-6-2-4-7(8)5-3-6/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2388 |
| Density: | 1 |
| Stability: | No data. |
| Refractive index: | 1.4674-1.4694 |
| Water Solubility: | immiscible |
| Solubility: | immiscible |
| Appearance: | A colorless liquid with an aromatic odor. |
| Specification: |
? 4-Fluorotoluene (CAS NO.352-32-9), its Synonyms are 1-Fluoro-4-methylbenzene ; 1-Methyl-4-fluorobenzene ; p-Fluoromethyl benzene ; p-Fluoromethylbenzene ; p-Fluorotoluene ; Benzene, 1-fluoro-4-methyl- ; Toluene, p-fluoro . It is clear colorless to slightly yellow liquid. |
| Packinggroup: | II |
| HS Code: | 29036990 |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols |
F:Flammable
Xi:Irritant
|
 |
|
