| Identification | |
| Name: | Poly[oxy(methyl-1,2-ethanediyl)],a-methyl-w-hydroxy- |
| Synonyms: | AdekaCarpol ML 250; D 1012; DF 1012; DF 1012 (frother); DF 200; DF 200 (frother); DF250; DF 250 (frother); Dowfroth 250; Jeffox OL 2700; Methoxy polypropyleneglycol; Nasfroth AHE; Newpol LB 625; Nissan Uniol MME; PF-X 716; PPG-LX 865;Poly(oxypropylene) monomethyl ether; Polyoxypropylene glycol monomethyl ether;Polyoxypropylene methyl ether; Polypropylene glycol methyl ether; Polypropyleneglycol methyl monoether; Polypropylene glycol monomethyl ether; Polypropyleneglycol monomethyl ether-silica graft copolymer; Propylene oxide-methanoladduct; Sumaku MP 40 |
| CAS: | 37286-64-9 |
| Molecular Formula: | (C3H6 O)n C H4 O |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C7H16O3/c1-6(8)4-10-7(2)5-9-3/h6-8H,4-5H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 76.7°C |
| Boiling Point: | 203.3°Cat760mmHg |
| Density: | 0.955g/cm3 |
| Specification: |
PPG-3 Methyl Ether (CAS NO.37286-64-9) is a colorless liquids with a mild, pleasant odor. |
| Report: |
Glycol ether compounds are on the Community Right-To-Know List. Reported in EPA TSCA Inventory. |
| Flash Point: | 76.7°C |
| Safety Data | |
 |
|
