| Identification | |
| Name: | 3-Piperidinecarboxylicacid, 4-oxo-1-(phenylmethyl)-, methyl ester, hydrochloride (1:1) |
| Synonyms: | 3-Piperidinecarboxylicacid, 4-oxo-1-(phenylmethyl)-, methyl ester, hydrochloride (9CI); Nipecoticacid, 1-benzyl-4-oxo-, methyl ester, hydrochloride (7CI,8CI);1-Benzyl-3-(methoxycarbonyl)-4-oxopiperidine monohydrochloride;1-Benzyl-3-carbomethoxy-4-piperidone hydrochloride;1-Benzyl-4-oxo-3-piperidinecarboxylic acid methyl ester monohydrochloride;1-Benzyl-4-oxopiperidine-3-carboxylic acid methyl ester hydrochloride; Methyl1-benzyl-4-oxo-3-piperidinecarboxylate hydrochloride |
| CAS: | 3939-01-3 |
| EINECS: | 223-522-2 |
| Molecular Formula: | C14H17 N O3 . Cl H |
| Molecular Weight: | 283.75 |
| InChI: | InChI=1/C14H17NO3.ClH/c1-18-14(17)12-10-15(8-7-13(12)16)9-11-5-3-2-4-6-11;/h2-6,12H,7-10H2,1H3;1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 175.2°C |
| Boiling Point: | 366°Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
Methyl 1-benzyl-4-oxo-3-piperidine-carboxylate hydrochloride , its cas register number is 3939-01-3. It also can be called 1-Benzyl-3-carbomethoxy-4-piperidone hydrochloride ; 3-Piperidinecarboxylicacid, 4-oxo-1-(phenylmethyl)-, methyl ester, hydrochloride (1:1) .It is a white to pink crystalline powder. |
| Flash Point: | 175.2°C |
| Sensitive: | Hygroscopic |
| Safety Data | |
 |
|
