| Identification | |
| Name: | 2-Fluorobenzaldehyde |
| Synonyms: | Fluorobenzaldehyde1; Fluorobenzaldehydemincolorlessliq; 2-Fluorobenzaldeyde |
| CAS: | 446-52-6 |
| EINECS: | 207-171-2 |
| Molecular Formula: | C7H5FO |
| Molecular Weight: | 124.11 |
| InChI: | InChI=1/C7H5FO/c8-7-4-2-1-3-6(7)5-9/h1-5H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1989 |
| Density: | 1.178 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5205-1.5225 |
| Water Solubility: | INSOLUBLE |
| Solubility: | insoluble |
| Appearance: | clear to yellow liquid |
| Specification: | clear colorless to light brown liquid Safety Statements:16-26-36-37/39 16:Keep away from sources of ignition - No smoking 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | III |
| HS Code: | 29130000 |
| Storage Temperature: | Flammables area |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
