| Identification |
| Name: | nordihydroguaiaretic acid |
| Synonyms: | 4,4-(2,3-Dimethyltetramethylene)dipyrocatechol; NDGA, Larrea divaricata; 1,4-Bis(3,4-dihydroxyphenyl)-2,3-dimethylbutane |
| CAS: | 500-38-9 |
| EINECS: | 207-903-0 |
| Molecular Formula: | C18H22O4 |
| Molecular Weight: | 302.37 |
| InChI: | InChI=1/C18H22O4/c1-11(7-13-3-5-15(19)17(21)9-13)12(2)8-14-4-6-16(20)18(22)10-14/h3-6,9-12,19-22H,7-8H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | HAZARD |
| Density: | 1.241 g/cm3 |
| Stability: | Stable. Incompatible with oxidizing agents. |
| Refractive index: | 1.626 |
| Water Solubility: | slightly soluble |
| Solubility: | slightly soluble in water |
| Appearance: | white
to off-white powder |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
