| Identification | |
| Name: | Thiolacetic acid |
| Synonyms: | Ethanethioic acid; Thioacetic acid |
| CAS: | 507-09-5 |
| EINECS: | 208-063-8 |
| Molecular Formula: | C2H4OS |
| Molecular Weight: | 76.11 |
| InChI: | InChI=1/C2H4OS/c1-2(3)4/h1H3,(H,3,4) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2436 |
| Density: | 1.065 |
| Stability: | Stable. Flammable. Incompatible with metals, strong oxidizing agents. |
| Refractive index: | 1.463-1.465 |
| Solubility: | 27 g/L (15 °C) (hydrolyse) in water |
| Appearance: | clear,yellow liquid with a strong, unpleasant odor |
| Specification: |
Thioacetic acid (CAS NO.507-09-5), its Synonyms are Ethanethioic acid ; Ethanethiolic acid ; Kyselina thiooctova ; Thionoacetic acid ; Thionoacetic acid ; Acetic acid, thio- ; Schiff's reagent . |
| Packinggroup: | II |
| HS Code: | 29309070 |
| Storage Temperature: | Refrigerator |
| Usage: | Used to make other chemicals. |
| Safety Data | |
| Hazard Symbols |
F:Flammable
C:Corrosive
|
 |
|
