| Identification | |
| Name: | DL-Homatropine hydrobromide |
| Synonyms: | Homatropine Hydrobromide; Homatropine HBr |
| CAS: | 51-56-9 |
| EINECS: | 200-105-3 |
| Molecular Formula: | C16H21NO3?HBr |
| Molecular Weight: | 356.26 |
| InChI: | InChI=1/C16H21NO3.BrH/c1-17-12-7-8-13(17)10-14(9-12)20-16(19)15(18)11-5-3-2-4-6-11;/h2-6,12-15,18H,7-10H2,1H3;1H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1544 |
| Density: | 1.21g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | soluble |
| Solubility: | Soluble in water |
| Appearance: | Colorless or white powder. Bromine-like odor. |
| Specification: |
Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances.Wash thoroughly after handling. Use with adequate ventilation. Minimize dust generation and accumulation. Avoid contact with eyes, skin, and clothing. Keep container tightly closed. Avoid ingestion and inhalation. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | I; II; III |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Given as eye drops to dilate the pupil and relax the lens so that eye examinations can be carried out thoroughly. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
