| Identification | |
| Name: | b-D-Glucopyranoside, cyclohexyl |
| Synonyms: | Glucopyranoside,cyclohexyl, b-D-(7CI,8CI); Cyclohexyl b-D-glucopyranoside; Cyclohexyl b-D-glucoside; NSC 226971 |
| CAS: | 5284-99-1 |
| Molecular Formula: | C12H22 O6 |
| Molecular Weight: | 262.30 |
| InChI: | InChI=1/C12H22O6/c13-6-8-9(14)10(15)11(16)12(18-8)17-7-4-2-1-3-5-7/h7-16H,1-6H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 230.3°C |
| Boiling Point: | 457.2°C at 760 mmHg |
| Density: | 1.34 |
| Refractive index: | 1.557 |
| Specification: |
The Cyclohexyl beta-D-glucopyranoside with the CAS number 5284-99-1 is also called b-D-Glucopyranoside, cyclohexyl. The systematic name is cyclohexyl hexopyranoside. Its molecular formula is C12H22O6. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the chemical are: (1)ACD/LogP: -0.63; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 6; (4)#H bond donors: 4; (5)#Freely Rotating Bonds: 7; (6)Polar Surface Area: 55.38 Å2; (7)Index of Refraction: 1.557; (8)Molar Refractivity: 63.01 cm3; (9)Molar Volume: 195.4 cm3; (10)Polarizability: 24.98×10-24cm3; (11)Surface Tension: 61.8 dyne/cm; (12)Enthalpy of Vaporization: 82.73 kJ/mol; (13)Vapour Pressure: 2.79×10-10 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Flash Point: | 230.3°C |
| Safety Data | |
 |
|
