| Identification | |
| Name: | 2-Acetamidoacrylic acid |
| Synonyms: | Ac-DL-Dha-OH~N-Acetyldehydroalanine |
| CAS: | 5429-56-1 |
| EINECS: | 226-583-3 |
| Molecular Formula: | C5H7NO3 |
| Molecular Weight: | 129.11 |
| InChI: | InChI=1/C5H7NO3/c1-3(5(8)9)6-4(2)7/h1H2,2H3,(H,6,7)(H,8,9) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.212 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | hardly soluble |
| Solubility: | hardly soluble in water |
| Appearance: | white to off-white crystalline powder |
| Specification: |
2-Acetamidoacrylic acid , its cas register number is 5429-56-1. It also can be called 2-Propenoic acid,2-(acetylamino)- ; 2-(Acetylamino)-2-propenoic acid .It is a white to off-white powder. |
| HS Code: | 29241900 |
| Storage Temperature: | Refrigerator |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
