| Identification | |
| Name: | b-D-Glucopyranosiduronic acid,4-(acetylamino)phenyl, methyl ester |
| Synonyms: | 4-ACETAMIDOPHENYL B-D-GLUCOPYRANOSIDURONIC ACID, METHYL ESTER;4-Acetamidophenylb-D-glucuronidemethylester |
| CAS: | 570394-17-1 |
| Molecular Formula: | C15H19 N O8 |
| Molecular Weight: | 341.31326 |
| InChI: | InChI=1/C15H19NO8/c1-7(17)16-8-3-5-9(6-4-8)23-15-12(20)10(18)11(19)13(24-15)14(21)22-2/h3-6,10-13,15,18-20H,1-2H3,(H,16,17)/t10-,11-,12-,13?,15+/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 321.007°C |
| Boiling Point: | 607.173°C at 760 mmHg |
| Density: | 1.493g/cm3 |
| Refractive index: | 1.626 |
| Specification: | Off-White Powder usageEng:Intermediate in the preparation of Acetaminophen metabolites |
| Flash Point: | 321.007°C |
| Usage: | Intermediate in the preparation of Acetaminophen metabolites |
| Safety Data | |
 |
|
