| Identification |
| Name: | 2,6-Diethylaniline |
| Synonyms: | 2-Amino-1,3-diethylbenzene; |
| CAS: | 579-66-8 |
| EINECS: | 209-445-7 |
| Molecular Formula: | C10H15N |
| Molecular Weight: | 149.23 |
| InChI: | InChI=1/C10H15N/c1-3-8-6-5-7-9(4-2)10(8)11/h5-7H,3-4,11H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 190kgs |
| Density: | 0.906 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5446-1.5466 |
| Solubility: | Soluble |
| Appearance: | colorless to reddish brown liquid |
| Packinggroup: | III |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Do not expose to air. Store protected from light. Store under an inert atmosphere. |
| Sensitive: | Air Sensitive |
| Color: | Yellow liquid |
| Usage: | 2,6-Diethylaniline is an intermediate for the production of alachlor, butachlor, metolachlor-herbicides, tiafentiurone-insecticide, carbodiimide and RIM-PUR. Product Data Sheet |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
