| Identification | |
| Name: | 2,6-Dihydroxynaphthalene |
| Synonyms: | 2,6-NAPHTHALENEDIOL; naphthalene-2,6-diol; TIMTEC-BB SBB000129; 2,6-Naphthalenediol(2,6-Oh); 2,6-DihydroxylNaphthalene; 2,6-Dihydroxynaphthalin; 2.6-DIHYDROXYNAPHTHALENE98% |
| CAS: | 581-43-1 |
| EINECS: | 209-465-6 |
| Molecular Formula: | C10H8O2 |
| Molecular Weight: | 160.16932 |
| InChI: | InChI=1S/C10H8O2/c11-9-3-1-7-5-10(12)4-2-8(7)6-9/h1-6,11-12H |
| Molecular Structure: |  |
| Properties | |
| Transport: | HAZARD |
| Density: | 1.33 g/cm3 |
| Stability: | Decomposition will not occur if used and stored according to specifications. |
| Refractive index: | 1.725 |
| Water Solubility: | slightly soluble AUTOIGNITION |
| Solubility: | slightly
soluble
AUTOIGNITION
|
| Appearance: | grey to brown powder |
| Specification: | Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Storage Temperature: | Keep container tightly sealed. Store in cool, dry conditions in well sealed containers. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
