| Identification | |
| Name: | Dimethyl methylmalonate |
| Synonyms: | Malonicacid, methyl-, dimethyl ester (6CI,7CI,8CI);Propanedioic acid, methyl-,dimethyl ester (9CI);Dimethyl 2-methylmalonate;Methylmalonic acid dimethyl ester;Methylpropanedioic acid dimethyl ester;NSC143779; |
| CAS: | 609-02-9 |
| EINECS: | 210-173-6 |
| Molecular Formula: | C6H10O4 |
| Molecular Weight: | 146.14 |
| InChI: | InChI=1/C6H10O4/c1-4(5(7)9-2)6(8)10-3/h4H,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -46 |
| Density: | 1.098 |
| Refractive index: | 1.414 |
| Solubility: | Soluble |
| Appearance: | Colorless liquid |
| Specification: |
Dimethyl methylmalonate , its cas register number is 609-02-9. It also can be called Malonic acid, methyl-, dimethyl ester (8CI) ; Propanedioic acid, 2-methyl-, 1,3-dimethyl ester ; Propanedioic acid, methyl-, dimethyl ester .It is a colorless liquid. |
| Storage Temperature: | Keep away from heat and open flame. Store in a cool dry place. |
| Safety Data | |
 |
|
