| Identification | |
| Name: | N-Ethyl-N-(3-hydroxypropyl)nitrosamine |
| Synonyms: | N-ethyl-N-(3-hydroxypropyl)nitrosamine |
| CAS: | 61734-88-1 |
| Molecular Formula: | C5H12N2O2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C5H12N2O2/c1-2-7(6-9)4-3-5-8/h8H,2-5H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 129.1°C |
| Boiling Point: | 289.8°C at 760 mmHg |
| Density: | 1.08g/cm3 |
| Refractive index: | 1.471 |
| Specification: |
N-Ethyl-N-(3-hydroxypropyl)nitrosamine , its cas register number is 61734-88-1. It also can be called BRN 2238807 ; Propanol, 3-(ethylnitrosoamino)- . When heated to decomposition it emits toxic fumes of NOx. |
| Flash Point: | 129.1°C |
| Safety Data | |
 |
|
