| Identification | |
| Name: | N-Isopropyl-N-(acetoxymethyl)nitrosamine |
| Synonyms: | Methanol, ((1-methylethyl)nitrosoamino)-, acetate (ester) (9CI) |
| CAS: | 70715-91-2 |
| Molecular Formula: | C6H12N2O3 |
| Molecular Weight: | 160.1711 |
| InChI: | InChI=1/C6H12N2O3/c1-5(2)8(7-10)4-11-6(3)9/h5H,4H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 110.7°C |
| Boiling Point: | 259.5°C at 760 mmHg |
| Density: | 1.12g/cm3 |
| Refractive index: | 1.467 |
| Specification: |
N-Isopropyl-N-(acetoxymethyl)nitrosamine , its cas register number is 70715-91-2. It also can be called Methanol, ((1-methylethyl)nitrosoamino)-, acetate (ester) (9CI) ; Acetic acid, (isopropylnitrosoamino)methyl ester ; and N-iso-Propyl-N-(acetoxymethyl)nitrosamine . |
| Flash Point: | 110.7°C |
| Safety Data | |
 |
|
