| Identification | |
| Name: | 5-Bromo-9,10-dimethyl-1,2-benzanthracene |
| Synonyms: | 8-Bromo-7,12-dimethylbenz[a]anthracene |
| CAS: | 63018-63-3 |
| Molecular Formula: | C20H15Br |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C20H15Br/c1-12-15-8-5-9-18(21)20(15)13(2)16-11-10-14-6-3-4-7-17(14)19(12)16/h3-11H,1-2H3 |
| Molecular Structure: | ![(C20H15Br) 8-Bromo-7,12-dimethylbenz[a]anthracene](https://img.guidechem.com/crawlimg/63018-63-3.png) |
| Properties | |
| Flash Point: | 256.8°C |
| Boiling Point: | 506.9°C at 760 mmHg |
| Density: | 1.393g/cm3 |
| Refractive index: | 1.741 |
| Specification: |
5-Bromo-9,10-dimethyl-1,2-benzanthracene (CAS NO.63018-63-3) is also named as 3-05-00-02414 (Beilstein Handbook Reference) ; 8-Bromo-7,12-dimethylbenz(a)anthracene ; BRN 3334755 ; Benz(a)anthracene, 8-bromo-7,12-dimethyl- . 5-Bromo-9,10-dimethyl-1,2-benzanthracene (CAS NO.63018-63-3) is toxic. It will produce toxic bromide smoke when buring. So the storage environment should be ventilate, low-temperature and dry. |
| Flash Point: | 256.8°C |
| Safety Data | |
 |
|
