| Identification | |
| Name: | D-Glucose, 4-O-a-D-glucopyranosyl-,hydrate (1:1) |
| CAS: | 6363-53-7 |
| EINECS: | 200-716-5 |
| Molecular Formula: | C12H24O12 |
| Molecular Weight: | 360.31 |
| InChI: | InChI=1S/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5-,6+,7-,8-,9-,10-,11+,12-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 130 oC |
| Density: | 1.76g/cm3 |
| Alpha: | 137 o (C=4, H2O, NH3) |
| Water Solubility: | 1080 G/L (20 oC) |
| Solubility: | 1080 g/L (20 oc) |
| Appearance: | powder |
| Specification: | White crystalline powder usageEng:A disaccharide commonly found in foods and commonly utilized in brewing processes. Safety Statements:24/25-36-26 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Storage Temperature: | Store at RT. |
| Usage: | A disaccharide commonly found in foods and commonly utilized in brewing processes. |
| Safety Data | |
 |
|
