Identification |
Name: | decanoic acid, compound with 2-(isopropylamino)ethanol (1:1) |
Synonyms: | Decanoic acid, compd. with 2-((1-methylethyl)amino)ethanol (1:1);Decanoic acid isopropylaminoethanol salt;Isopropylaminoethanol caprate;Decanoic acid, compound with 2-(isopropylamino)ethanol (1:1);decanoic acid - 2-(propan-2-ylamino)ethanol (1:1) |
CAS: | 64601-15-6 |
EINECS: | 264-960-4 |
Molecular Formula: | C15H33NO3 |
Molecular Weight: | 275.4274 |
InChI: | InChI=1/C10H20O2.C5H13NO/c1-2-3-4-5-6-7-8-9-10(11)12;1-5(2)6-3-4-7/h2-9H2,1H3,(H,11,12);5-7H,3-4H2,1-2H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 121.8°C |
Boiling Point: | 269.6°C at 760 mmHg |
Flash Point: | 121.8°C |
Safety Data |
|
 |