| Identification | |
| Name: | 5H-Dibenz[b,f]azepine-5-propanamine,10,11-dihydro-N,N-di(methyl-d3)- (9CI) |
| Synonyms: | Imipramine-D6;10,11-Dihydro-N,N-di(methyl-d3)-5H-dibenz[b,f]azepine-5-propanamin;(10,11-Dihydro-N,N-di(methyl-d3)-5H-dibenz[b,f]azepine-5-propanamine) |
| CAS: | 65100-45-0 |
| Molecular Formula: | C19H18 D6 N2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C19H24N2/c1-20(2)14-7-15-21-18-10-5-3-8-16(18)12-13-17-9-4-6-11-19(17)21/h3-6,8-11H,7,12-15H2,1-2H3/i1D3,2D3 |
| Molecular Structure: | ![(C19H18D6N2) Imipramine-D6;10,11-Dihydro-N,N-di(methyl-d3)-5H-dibenz[b,f]azepine-5-propanamin;(10,11-Dihydro-N,N-...](https://img1.guidechem.com/chem/e/dict/11/65100-45-0.jpg) |
| Properties | |
| Flash Point: | 179.73°C |
| Boiling Point: | 403.089°C at 760 mmHg |
| Density: | 1.064g/cm3 |
| Refractive index: | 1.575 |
| Specification: | Pale Yellow Oil usageEng:Labelled tricyclic antidepressant; inhibits the serotonin and norepinephrine transporters. Has little effect on the dopamine transporter |
| Flash Point: | 179.73°C |
| Usage: | Labelled tricyclic antidepressant; inhibits the serotonin and norepinephrine transporters. Has little effect on the dopamine transporter |
| Safety Data | |
 |
|
