Identification |
Name: | D-gluconic acid, compound with 2,2'-iminobisethanol (1:1) |
Synonyms: | D-Gluconic acid, compd. with 2,2'-iminobis(ethanol) (1:1);Gluconic acid, diethanolamine salt;D-Gluconic acid, compound with 2,2'-iminobisethanol (1:1);2,2'-iminodiethanol - D-gluconic acid (1:1) |
CAS: | 66808-27-3 |
EINECS: | 266-485-8 |
Molecular Formula: | C10H23NO9 |
Molecular Weight: | 301.2909 |
InChI: | InChI=1/C6H12O7.C4H11NO2/c7-1-2(8)3(9)4(10)5(11)6(12)13;6-3-1-5-2-4-7/h2-5,7-11H,1H2,(H,12,13);5-7H,1-4H2/t2-,3-,4+,5-;/m1./s1 |
Molecular Structure: |
 |
Properties |
Flash Point: | 375.2°C |
Boiling Point: | 673.6°C at 760 mmHg |
Flash Point: | 375.2°C |
Safety Data |
|
 |