| Identification | |
| Name: | benzoic acid, compound with 2,2'-iminobisethanol (1:1) |
| Synonyms: | Ethanol, 2,2'-iminobis-, benzoate (1:1);Benzoic acid, diethanolamine salt;Diethanolamine benzoate;Benzoic acid, compd. with 2,2'-iminobis(ethanol) (1:1);Benzoic acid, compound with 2,2'-iminobisethanol (1:1);Ethanol, 2,2'-iminobis-, benzoate (salt);2-(2-hydroxyethylamino)ethanol benzoate;2-hydroxy-N-(2-hydroxyethyl)ethanaminium benzoate |
| CAS: | 53926-87-7 |
| EINECS: | 258-867-8 |
| Molecular Formula: | C11H17NO4 |
| Molecular Weight: | 227.257 |
| InChI: | InChI=1/C7H6O2.C4H11NO2/c8-7(9)6-4-2-1-3-5-6;6-3-1-5-2-4-7/h1-5H,(H,8,9);5-7H,1-4H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 235.8°C |
| Boiling Point: | 466.3°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 235.8°C |
| Safety Data | |
 |
|
