| Identification |
| Name: | 2,6-Dimethylchlorobenzene;2-Chloro-m-xylene |
| Synonyms: | m-Xylene,2-chloro- (7CI,8CI); 1-Chloro-2,6-dimethylbenzene; 2,6-Dimethylchlorobenzene;2,6-Dimethylphenyl chloride; 2-Chloro-1,3-dimethylbenzene; 2-Chloro-m-xylene |
| CAS: | 6781-98-2 |
| EINECS: | 229-843-4 |
| Molecular Formula: | C8H9Cl |
| Molecular Weight: | 140.61 |
| InChI: | InChI=1/C8H9Cl/c1-6-4-3-5-7(2)8(6)9/h3-5H,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 1993 |
| Density: | 1.061 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.525-1.528 |
| Solubility: | Insoluble |
| Appearance: | Clear colourless to light yellow liquid |
| Packinggroup: | I; II; III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
