| Identification | |
| Name: | oleic acid, compound with 2-(diethylamino)ethanol (1:1) |
| Synonyms: | oleic acid, compound with 2-(diethylamino)ethanol (1:1);9-Octadecenoic acid (9Z)-, compd.with 2-(diethylamino)ethanol;(Z)-9-Octadecenoic acid compd. with 2-(diethylamino) ethanol (1:1) |
| CAS: | 67923-77-7 |
| EINECS: | 267-784-6 |
| Molecular Formula: | C18H34O2.C6H15NO |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C18H34O2.C6H15NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-3-7(4-2)5-6-8/h9-10H,2-8,11-17H2,1H3,(H,19,20);8H,3-6H2,1-2H3/b10-9-; |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 270.1°C |
| Boiling Point: | 360°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 270.1°C |
| Safety Data | |
 |
|
