| Identification | |
| Name: | formic acid, compound with 1,4-diazabicyclo[2.2.2]octane |
| Synonyms: | Formic acid, compd. with 1,4-diazabicyclo(2.2.2)octane (1:?);Formic acid, compd. with 1,4-diazabicyclo(2.2.2)octane;Formic acid, compound with 1,4-diazabicyclo(2.2.2)octane;formic acid - 1,4-diazabicyclo[2.2.2]octane (1:1) |
| CAS: | 68227-30-5 |
| EINECS: | 269-344-9 |
| Molecular Formula: | C7H14N2O2 |
| Molecular Weight: | 158.1983 |
| InChI: | InChI=1/C6H12N2.CH2O2/c1-2-8-5-3-7(1)4-6-8;2-1-3/h1-6H2;1H,(H,2,3) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 62.2°C |
| Boiling Point: | 174°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 62.2°C |
| Safety Data | |
 |
|
