| Identification |
| Name: | ethyl dihydrogen phosphate, compound with triethylamine |
| Synonyms: | Phosphoric acid, monoethyl ester, compd. with N,N-diethylethanamine (1:?);Ethyl dihydrogen phosphate, compound with triethylamine;Phosphoric acid, monoethyl ester, compd. with N,N-diethylethanamine;ethyl dihydrogen phosphate - N,N-diethylethanamine (1:1) |
| CAS: | 68318-37-6 |
| EINECS: | 269-761-6 |
| Molecular Formula: | C8H22NO4P |
| Molecular Weight: | 227.2383 |
| InChI: | InChI=1/C6H15N.C2H7O4P/c1-4-7(5-2)6-3;1-2-6-7(3,4)5/h4-6H2,1-3H3;2H2,1H3,(H2,3,4,5) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 151.3°C |
| Boiling Point: | 90.5°C at 760 mmHg |
| Flash Point: | 151.3°C |
| Safety Data |
| |
 |
