| Identification |
| Name: | [nitrilotris(methylene)]trisphosphonic acid, compound with 2,2'-iminobis[ethanol] 2,2',2''-nitrilotris[ethanol] |
| Synonyms: | Phosphonic acid, P,P',P''-(nitrilotris(methylene))tris-, compd. with 2,2'-iminobis(ethanol) and 2,2',2''-nitrilotris(ethanol) (1:?:?);Aminotris(methylphosphonic acid), triethanolamine and diethanolamine mixed salts;(Nitrilotris(methylene))trisphosphonic acid, compound with 2,2'-iminobis(ethanol) 2,2',2''-nitrilotris(ethanol);Phosphonic acid, (nitrilotris(methylene))tris-, compd. with 2,2'-iminobis(ethanol) and 2,2',2''-nitrilotris(ethanol);2-(bis(2-hydroxyethyl)amino)ethanol; (bis(phosphonomethyl)amino)methylphosphonic acid; 2-(2-hydroxyethylamino)ethanol |
| CAS: | 68413-73-0 |
| EINECS: | 270-246-3 |
| Molecular Formula: | C13H38N3O14P3 |
| Molecular Weight: | 553.3738 |
| InChI: | InChI=1/C6H15NO3.C4H11NO2.C3H12NO9P3/c8-4-1-7(2-5-9)3-6-10;6-3-1-5-2-4-7;5-14(6,7)1-4(2-15(8,9)10)3-16(11,12)13/h8-10H,1-6H2;5-7H,1-4H2;1-3H2,(H2,5,6,7)(H2,8,9,10)(H2,11,12,13) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 405.1°C |
| Boiling Point: | 746.2°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 405.1°C |
| Safety Data |
| |
 |
