| Identification | |
| Name: | 2,4-Dichlorophenylboronic acid |
| Synonyms: | Boronicacid, (2,4-dichlorophenyl)- (9CI);(2,4-Dichlorophenyl)boronic acid;Boronicacid, B-(2,4-dichlorophenyl)-; |
| CAS: | 68716-47-2 |
| Molecular Formula: | C6H5BCl2O2 |
| Molecular Weight: | 190.82 |
| InChI: | InChI=1/C6H5BCl2O2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,10-11H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 154.2 ºC |
| Boiling Point: | 331.3 ºC at 760 mmHg |
| Density: | 1.47 g/cm3 |
| Refractive index: | 1.577 |
| Appearance: | white to off-white powder |
| Specification: |
?2,4-Dichlorophenylboronic acid (CAS NO.68716-47-2), its Synonyms are 2,4-Dichlorobenzeneboronicacid, 98% ; 2,4-Dichlorophenylboronic acid (contains varying amounts of Anhydride) ; Boronic acid derivative . It is white to off-white powder. |
| Flash Point: | 154.2 ºC |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
