| Identification | |
| Name: | (C8-C26) Alkylalcohol adipate diester |
| Synonyms: | DIETHYL ADIPATE;Diethyl hexanedioate;Ethyl adipate;Adipic acid, diethyl ester;Hexanedioic acid, diethyl ester;141-28-6;1,6-Diethyl hexanedioate;Diethylhexanedioic acid;Hexanedioic acid, diethyl-;hexanedioic acid diethyl ester;Ethyl delta-carboethoxyvalerate;ADIPIC ACID DIETHYL ESTER;HSDB 5413;EINECS 205-477-0;Diethylester kyseliny adipove [Czech];NSC 19160;BRN 1780035;AI3-00342;WLN: 2OV4VO2;Ethyl .delta.-carboethoxyvalerate;Di-C8-26-alkyl adipates;AC1L1RT7;AC1Q34RQ;AC1Q34RR;Diethylester kyseliny adipove;BIDD:ER0365;245720_ALDRICH;NSC3363;MolPort-001-779-655;NSC-3363;NSC19160;AR-1I9628;Hexanedioic acid, 1,6-diethyl ester;NSC-19160;SBB060572;ZINC01666736;(C8-C26) Alkylalcohol adipate diester;Hexanedioic acid, C18-28-alkyl esters;Hexanedioic acid, di-C8-26-alkyl esters;LS-15244;(C18-C28) Alcohol ester of adipic acid;A0162;EN300-19693;C14566;A807746;S14-1430;68201-71-8;68989-28-6 |
| CAS: | 68989-28-6 |
| Molecular Formula: | C10H18O4 |
| Molecular Weight: | 202.24752 |
| InChI: | InChI=1S/C10H18O4/c1-3-13-9(11)7-5-6-8-10(12)14-4-2/h3-8H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -19.8 deg C |
| Solubility: | Soluble in ethanol and ethyl ether In water, 4230 mg/l @ 20 deg C |
| Color: | Colorless liquid |
| Safety Data | |
 |
|
