| Identification |
| Name: | 3,4,5-Piperidinetriol,2-(hydroxymethyl)-1-methyl-, (2R,3R,4R,5S)- |
| Synonyms: | 3,4,5-Piperidinetriol,2-(hydroxymethyl)-1-methyl-, [2R-(2a,3b,4a,5b)]-; MOR 14; N-Methyl-1-deoxynojirimycin; N-Methylmoranolin;N-Methylmoranoline |
| CAS: | 69567-10-8 |
| EINECS: | 203-703-2 |
| Molecular Formula: | C7H15 N O4 |
| Molecular Weight: |
177.20 |
| InChI: | InChI=1/C7H15NO4/c1-8-2-5(10)7(12)6(11)4(8)3-9/h4-7,9-12H,2-3H2,1H3/t4-,5+,6-,7-/m1/s1 |
| Molecular Structure: |
![(C7H15NO4) 3,4,5-Piperidinetriol,2-(hydroxymethyl)-1-methyl-, [2R-(2a,3b,4a,5b)]-; MOR 14; N-Methyl-1-deoxynoji...](https://img1.guidechem.com/chem/e/dict/58/69567-10-8.jpg) |
| Properties |
| Flash Point: | 220.3°C |
| Boiling Point: | 367.2°C at 760 mmHg |
| Density: | 1.394g/cm3 |
| Refractive index: | 1.58 |
| Flash Point: | 220.3°C |
| Storage Temperature: | 2-8°C |
| Usage: | Interfers with the normal processing of N-linked glycoproteins by inhibiting the action of glucosidases that remove glycosyl residues from Glc3Man9GlcNAc2 following the addition of this moiety to a nascent polypeptide |
| Safety Data |
| |
 |
