| Identification | |
| Name: | 3,4,5-Piperidinetriol,2-(hydroxymethyl)-, hydrochloride (1:1), (2R,3R,4R,5S)- |
| Synonyms: | 3,4,5-Piperidinetriol,2-(hydroxymethyl)-, hydrochloride, (2R,3R,4R,5S)- (9CI);3,4,5-Piperidinetriol,2-(hydroxymethyl)-, hydrochloride, [2R-(2a,3b,4a,5b)]-;(+)-1-Deoxynojirimycin hydrochloride;1-Deoxynojirimycin hydrochloride;AT 2220;Duvoglustat hydrochloride;Moranoline hydrochloride; |
| CAS: | 73285-50-4 |
| EINECS: | 163.1717 |
| Molecular Formula: | C6H13NO4.HCl |
| Molecular Weight: | 163.17 |
| InChI: | InChI=1/C6H13NO4.ClH/c8-2-3-5(10)6(11)4(9)1-7-3;/h3-11H,1-2H2;1H/t3-,4+,5-,6-;/m1./s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 195-196 ºC |
| Density: | 1.456 g/cm3 |
| Specification: | White Crystalline Solid usageEng:Deoxynojirimycin inhibits mammalian glucosidase 1. As well, it inhibits intestinal and lysosmal alpha-glucosidases, beta-glucosidase from sweet almonds, pancreatic alpha-amylase and amyloglucosidase. Safety Statements:26-36-24/25-22 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 24/25:Avoid contact with skin and eyes 22:Do not breathe dust |
| Storage Temperature: | 2-8°C |
| Usage: | Deoxynojirimycin inhibits mammalian glucosidase 1. As well, it inhibits intestinal and lysosmal alpha-glucosidases, beta-glucosidase from sweet almonds, pancreatic alpha-amylase and amyloglucosidase. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
