| Identification | |
| Name: | Benzaldehyde,3-chloro-, 2-[(3-chlorophenyl)methylene]hydrazone |
| Synonyms: | Benzaldehyde,3-chloro-, [(3-chlorophenyl)methylene]hydrazone (9CI); Benzaldehyde, m-chloro-,azine (6CI,8CI); 3,3'-Dichlorobenzaldazine; 3,3'-Dichlorobenzylideneazine; NSC67224; m-Chlorobenzaldehyde azine |
| CAS: | 6971-97-7 |
| Molecular Formula: | C14H10 Cl2 N2 |
| Molecular Weight: | 277.15 |
| InChI: | InChI=1/C14H10Cl2N2/c15-13-5-1-3-11(7-13)9-17-18-10-12-4-2-6-14(16)8-12/h1-10H/b17-9+,18-10u |
| Molecular Structure: | ![(C14H10Cl2N2) Benzaldehyde,3-chloro-, [(3-chlorophenyl)methylene]hydrazone (9CI); Benzaldehyde, m-chloro-,azine (6...](https://img1.guidechem.com/chem/e/dict/42/6971-97-7.jpg) |
| Properties | |
| Transport: | UN 3077 9/PG 3 |
| Flash Point: | 188.331°C |
| Boiling Point: | 387.794°C at 760 mmHg |
| Density: | 1.21g/cm3 |
| Refractive index: | 1.59 |
| Specification: | Safety Statements:26-36/37-60-61 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37:Wear suitable protective clothing and gloves 60:This material and/or its container must be disposed of as hazardous waste 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Biological Activity: | Allosteric ligand for the metabotropic glutamate receptor mGlu 5 ; displays neutral modulation. Does not affect agonist-stimulated mGlu 5 responses, but blocks regulation of the receptor by other allosteric modulators such as DFB ([(3-Fluorophenyl)methylene]hydrazone-3-fluorobenzaldehyde ) and DMeOB ([(3-Methoxyphenyl)methylene]hydrazone-3-methoxybenzaldehyde ). |
| Flash Point: | 188.331°C |
| Storage Temperature: | 2-8°C |
| Color: | yellow |
| Safety Data | |
 |
|
