Identification |
Name: | 2-Propenoic acid, 2-methyl-, methyl ester, polymer with 1,6-hexanediyl di-2-propenoate and 1,2-propanediol mono(2-methyl-2-propenoate) |
Synonyms: | 2-Propenoic acid, 2-methyl-, methyl ester, polymer with 1,6-hexanediyl di-2-propenoate and 1,2-propanediol mono(2-methyl-2-propenoate) |
CAS: | 70225-13-7 |
Molecular Formula: | C24H38O9 |
Molecular Weight: | 0 |
InChI: | InChI=1/C12H18O4.C7H12O3.C5H8O2/c1-3-11(13)15-9-7-5-6-8-10-16-12(14)4-2;1-5(2)7(9)10-4-6(3)8;1-4(2)5(6)7-3/h3-4H,1-2,5-10H2;6,8H,1,4H2,2-3H3;1H2,2-3H3 |
Molecular Structure: |
|
Properties |
Flash Point: | 142.3°C |
Boiling Point: | 302.1°C at 760 mmHg |
Flash Point: | 142.3°C |
Safety Data |
|
|