| Identification | |
| Name: | 2,2-bis(hydroxymethyl)propane-1,3-diol; dodecanoic acid; 2-ethylhexanoic acid |
| Synonyms: | 2,2-bis(hydroxymethyl)propane-1,3-diol; dodecanoic acid; 2-ethylhexanoic acid;70693-35-5;AC1L3JDJ;AC1Q5W8N;Pentaerythritol, esters with lauric acid and 2-ethylhexoic acid;AR-1D1179;Pentaerythritol 2-ethylhexanoate laurate;Dodecanoic acid, mixed esters with 2-ethylhexanoic acid and pentaerythritol |
| CAS: | 70693-35-5 |
| Molecular Formula: | C25H52O8 |
| Molecular Weight: | 480.6756 |
| InChI: | InChI=1/C12H24O2.C8H16O2.C5H12O4/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;1-3-5-6-7(4-2)8(9)10;6-1-5(2-7,3-8)4-9/h2-11H2,1H3,(H,13,14);7H,3-6H2,1-2H3,(H,9,10);6-9H,1-4H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 134.1°C |
| Boiling Point: | 296.1°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 134.1°C |
| Safety Data | |
 |
|
