| Identification | |
| Name: | 2-ethylhexanoic acid; 3-(hydroxymethyl)pentane-1,5-diol; pentanoic acid |
| Synonyms: | 2-ethylhexanoic acid; 3-(hydroxymethyl)pentane-1,5-diol; pentanoic acid;AC1Q5VZE;AC1L39MJ;AR-1E1565;Trimethylol propane, ester with 2-ethylhexanoic acid and valeric acid;Trimethylolpropane ester of 2-ethylhexanoic acid and valeric acids;2-Ethylhexanoic acid mixed esters with trimethylolpropane and valeric acid;Hexanoic acid, 2-ethyl-, mixed esters with trimethylolpropane and valeric acid;68238-74-4 |
| CAS: | 68238-74-4;68937-30-4 |
| Molecular Formula: | C19H40O7 |
| Molecular Weight: | 380.5167 |
| InChI: | InChI=1/C8H16O2.C6H14O3.C5H10O2/c1-3-5-6-7(4-2)8(9)10;7-3-1-6(5-9)2-4-8;1-2-3-4-5(6)7/h7H,3-6H2,1-2H3,(H,9,10);6-9H,1-5H2;2-4H2,1H3,(H,6,7) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 116.6°C |
| Boiling Point: | 228°C at 760 mmHg |
| Flash Point: | 116.6°C |
| Safety Data | |
 |
|
