| Identification |
| Name: | oleic acid, compound with N,N-dimethyltetradecylamine (1:1) |
| Synonyms: | 9-Octadecenoic acid (9Z)-, compd. with N,N-dimethyl-1-tetradecanamine (1:1);Dimethylmyristylamine oleate;Oleic acid, compound with N,N-dimethyltetradecylamine (1:1);(9Z)-octadec-9-enoic acid - N,N-dimethyltetradecan-1-amine (1:1) |
| CAS: | 70715-11-6 |
| EINECS: | 274-814-1 |
| Molecular Formula: | C34H69NO2 |
| Molecular Weight: | 523.9172 |
| InChI: | InChI=1/C18H34O2.C16H35N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-4-5-6-7-8-9-10-11-12-13-14-15-16-17(2)3/h9-10H,2-8,11-17H2,1H3,(H,19,20);4-16H2,1-3H3/b10-9-; |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 270.1°C |
| Boiling Point: | 360°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 270.1°C |
| Safety Data |
| |
 |
