| Identification | |
| Name: | phthalic acid, compound with 1,3,5-triazine-2,4,6-triamine |
| Synonyms: | 1,2-Benzenedicarboxylic acid, compd. with 1,3,5-triazine-2,4,6-triamine (1:?);Phthalic acid, compd. with melamine;1,2-Benzenedicarboxylic acid, compd. with 1,3,5-triazine-2,4,6-triamine;Phthalic acid, compound with 1,3,5-triazine-2,4,6-triamine;benzene-1,2-dicarboxylic acid - 1,3,5-triazine-2,4,6-triamine (1:1) |
| CAS: | 72066-82-1 |
| EINECS: | 276-318-0 |
| Molecular Formula: | C11H12N6O4 |
| Molecular Weight: | 292.2508 |
| InChI: | InChI=1/C8H6O4.C3H6N6/c9-7(10)5-3-1-2-4-6(5)8(11)12;4-1-7-2(5)9-3(6)8-1/h1-4H,(H,9,10)(H,11,12);(H6,4,5,6,7,8,9) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 196.7°C |
| Boiling Point: | 378.3°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 196.7°C |
| Safety Data | |
 |
|
