| Identification | |
| Name: | Diphenyl-p-phenylenediamine |
| CAS: | 74-31-7 |
| EINECS: | 200-806-4 |
| Molecular Formula: | C18H16N2 |
| Molecular Weight: | 260.34 |
| InChI: | InChI=1/C18H16N2/c1-3-7-15(8-4-1)19-17-11-13-18(14-12-17)20-16-9-5-2-6-10-16/h1-14,19-20H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.2 |
| Stability: | Stable. Incompatible with strong acids, strong oxidizing agents |
| Refractive index: | 1.693 |
| Water Solubility: | insoluble AUTOIGNITION |
| Solubility: | insoluble AUTOIGNITION |
| Appearance: | light gray to brown powder |
| Specification: | grey powder Safety Statements:24-37-61 24:Avoid contact with skin 37:Wear suitable gloves 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Storage Temperature: | 2-8°C |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
