| Identification | |
| Name: | Dicyclopentenyloxyethyl methacrylate |
| Synonyms: | 2-(Tricyclo[5.2.1.0~2,6~]dec-4-en-8-yloxy)ethyl methacrylate;2-propenoic acid, 2-methyl-, 2-[(3a,4,5,6,7,7a-hexahydro-4,7-methano-1H-inden-5-yl)oxy]ethyl ester |
| CAS: | 75662-22-5 |
| EINECS: | 271-608-3 |
| Molecular Formula: | C16H22O3 |
| Molecular Weight: | 262.3441 |
| InChI: | InChI=1/C16H22O3/c1-10(2)16(17)19-7-6-18-15-9-11-8-14(15)13-5-3-4-12(11)13/h3,5,11-15H,1,4,6-9H2,2H3 |
| Molecular Structure: | ![(C16H22O3) 2-(Tricyclo[5.2.1.0~2,6~]dec-4-en-8-yloxy)ethyl methacrylate;2-propenoic acid, 2-methyl-, 2-[(3a,4,5...](https://img.guidechem.com/crawlimg/75662-22-5.png) |
| Properties | |
| Flash Point: | 149.7°C |
| Boiling Point: | 358.9°C at 760 mmHg |
| Density: | 1.1g/cm3 |
| Refractive index: | 1.527 |
| Specification: |
Dicyclopentenyloxyethyl methacrylate , its cas register number is 75662-22-5. It also can be called QM 657 ; 2-Propenoic acid, 2-methyl-, 2-((3a,4,5,6,7,7a-hexahydro-4,7-methano-1H-inden-5-yl)oxy)ethyl ester . Dicyclopentenyloxyethyl methacrylate (CAS NO.75662-22-5) will cause a skin and eye irritant . |
| Flash Point: | 149.7°C |
| Safety Data | |
 |
|
