| Identification | |
| Name: | Ethyl dipropylthiocarbamate (EPTC) |
| Synonyms: | Carbamicacid, dipropylthio-, S-ethyl ester (6CI,8CI); Carbamothioic acid, dipropyl-,S-ethyl ester (9CI); Alirox; EPTC; EPTC (herbicide); Eptam; Eptam 6E; FDA 1541;NSC 40486; Niptan; R 1608; S-Ethyl dipropylthiocarbamate; Stauffer R 1608;Torbin |
| CAS: | 759-94-4 |
| EINECS: | 212-073-8 |
| Molecular Formula: | C9H19 N O S |
| Molecular Weight: | 189.318 |
| InChI: | InChI=1S/C9H19NOS/c1-4-7-10(8-5-2)9(11)12-6-3/h4-8H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2902 |
| Flash Point: | 116 °C |
| Density: | 0.95 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.479 |
| Water Solubility: | 0.375 g/100 mL |
| Solubility: | 0.375 g/100 mL |
| Appearance: | light yellow liquid |
| Specification: |
S-ethyl-N,N-di-N-propylthiocarbamate (759-94-4) is used as an agricultural herbicide. This herbicide is safe for use on field corn, pop corn and sweet corn. Along with providing protection against nearly all grasses and many broadleaves, it is a key herbicide to control wild oats and hairy nightshade. It is soluble in many organic solvents. It is stable under normal temperatures and pressures. It should be stored in a well ventilated, secure area out of reach of children and domestic animals. |
| Report: |
Reported in EPA TSCA Inventory. EPA Genetic Toxicology Program. |
| Packinggroup: | III |
| Flash Point: | 116 °C |
| Storage Temperature: | 0-6°C |
| Color: | Colorless liquid Yellow liquid (technical) |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
