| Identification |
| Name: | Methacrylic acid |
| Synonyms: | 2-Methylpropenoic acid; 2-Methylacrylic acid |
| CAS: | 79-41-4 |
| EINECS: | 201-204-4 |
| Molecular Formula: | C4H6O2 |
| Molecular Weight: | 86.09 |
| InChI: | InChI=1/C4H6O2/c1-3(2)4(5)6/h1H2,2H3,(H,5,6) |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2531 |
| Density: | 1.015 |
| Stability: | May be stabilized by the addition of MEHQ (Hydroquinone methyl ether, ca. 250 ppm) or hydroquinone. In the absence of a stabilizer this material will readily polymerize. Combustible. Incompatible with strong oxidizing agents, hydrochloric acid. |
| Refractive index: | 1.4295-1.4315 |
| Solubility: | 9.7 g/100 mL (20 oC) |
| Appearance: | colourless liquid or crystals with an unpleasant odour. |
| Packinggroup: | II |
| Storage Temperature: | Indoors |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
