Identification |
Name: | 2-Propenoic acid,2-methyl-,esters,methyl ester,polymer with methyl 2-propenoate |
Synonyms: | 2-Propenoic acid, 2-methyl-, methyl ester, polymer with methyl 2-propenoate;methyl acrylate-methyl methacrylate copolymer;METHYL ACRYLATE-METHYL METHACRYLATE POLYMER;methyl methacrylate/ methyl acrylate copolymer |
CAS: | 9011-87-4 |
Molecular Formula: | C9H13O4- |
Molecular Weight: | 0 |
InChI: | InChI=1S/C5H8O2.C4H6O2/c1-4(2)5(6)7-3;1-3(2)4(5)6/h1H2,2-3H3;1H2,2H3,(H,5,6)/p-1 |
Molecular Structure: |
|
Properties |
Flash Point: | 10°C |
Boiling Point: | 100.3°Cat760mmHg |
Density: | g/cm3 |
Flash Point: | 10°C |
Safety Data |
|
|