Identification |
Name: | 2-Thiophenecarboxylicacid, 2-carboxyphenyl ester |
Synonyms: | 2-Thiophenecarboxylicacid ester with salicylic acid; Tenosal; YS 134 |
CAS: | 95232-68-1 |
Molecular Formula: | C12H8 O4 S |
Molecular Weight: | 0 |
InChI: | InChI=1/C12H8O4S/c13-11(14)8-4-1-2-5-9(8)16-12(15)10-6-3-7-17-10/h1-7H,(H,13,14) |
Molecular Structure: |
 |
Properties |
Flash Point: | 251.1°C |
Boiling Point: | 491.6°Cat760mmHg |
Density: | 1.419g/cm3 |
Refractive index: | 1.642 |
Flash Point: | 251.1°C |
Safety Data |
|
 |