Identification |
Name: | dibutyl (2Z)-but-2-enedioate - ethenyl acetate (1:1) |
Synonyms: | AC1O5VBW;2-Butenedioic acid (Z)-, dibutyl ester, polymer with ethenyl acetate;Vinyl acetate, dibutyl maleate polymer;dibutyl (Z)-but-2-enedioate; ethenyl acetate;2-Butenedioic acid (2Z)-, 1,4-dibutyl ester, polymer with ethenyl acetate;2-Butenedioic acid (2Z)-, dibutyl ester, polymer with ethenyl acetate;25035-90-9;31259-22-0;60842-96-8;62494-65-9;62628-34-6;73195-46-7;75923-62-5 |
CAS: | 25035-90-9;31259-22-0;60842-96-8;62628-34-6;73195-46-7;75923-62-5 |
Molecular Formula: | C16H26O6 |
Molecular Weight: | 314.374 |
InChI: | InChI=1/C12H20O4.C4H6O2/c1-3-5-9-15-11(13)7-8-12(14)16-10-6-4-2;1-3-6-4(2)5/h7-8H,3-6,9-10H2,1-2H3;3H,1H2,2H3/b8-7-; |
Molecular Structure: |
|
Properties |
Flash Point: | 136.4°C |
Boiling Point: | 280°C at 760 mmHg |
Flash Point: | 136.4°C |
Safety Data |
|
|