| Identification | |
| Name: | dibutyl (2Z)-but-2-enedioate - chloroethene (1:1) |
| Synonyms: | AC1O5VF8;2-Butenedioc acid (Z), dibutyl ester, chloroethene polymer;chloroethene; dibutyl (Z)-but-2-enedioate;2-Butenedioic acid (2Z)-, dibutyl ester, polymer with chloroethene;2-Butenedioic acid (Z)-, dibutyl ester, polymer with chloroethene;2-Butenedioic acid (2Z)-, 1,4-dibutyl ester, polymer with chloroethene;28476-83-7;51374-44-8 |
| CAS: | 28476-83-7;51374-44-8 |
| Molecular Formula: | C14H23ClO4 |
| Molecular Weight: | 290.783 |
| InChI: | InChI=1/C12H20O4.C2H3Cl/c1-3-5-9-15-11(13)7-8-12(14)16-10-6-4-2;1-2-3/h7-8H,3-6,9-10H2,1-2H3;2H,1H2/b8-7-; |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 136.4°C |
| Boiling Point: | 280°C at 760 mmHg |
| Flash Point: | 136.4°C |
| Safety Data | |
 |
|
