| Identification | |
| Name: | 1,1-dichloroethylene; methyl 2-methylprop-2-enoate; 2-methylprop-2-enenitrile |
| Synonyms: | 1,1-dichloroethylene; methyl 2-methylprop-2-enoate; 2-methylprop-2-enenitrile;123425-40-1;37357-65-6;AC1L53PI;AC1Q4Q4N;KST-1B3693;AR-1B4562;Vinylidene chloride, methacrylonitrile, methyl methacrylate copolymer;1,1-dichloroethene; methyl 2-methylprop-2-enoate; 2-methylprop-2-enenitrile;2-Propenoic acid, 2-methyl-, methyl ester, polymer with 1,1-dichloroethene and 2-methyl-2-propenenitrile |
| CAS: | 123425-40-1;32335-23-2 |
| Molecular Formula: | C11H15Cl2NO2 |
| Molecular Weight: | 264.1483 |
| InChI: | InChI=1/C5H8O2.C4H5N.C2H2Cl2/c1-4(2)5(6)7-3;1-4(2)3-5;1-2(3)4/h1H2,2-3H3;1H2,2H3;1H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 10°C |
| Boiling Point: | 100.3°C at 760 mmHg |
| Flash Point: | 10°C |
| Safety Data | |
 |
|
