| Identification | |
| Name: | ethenol; methyl 2-methylprop-2-enoate; prop-2-enenitrile |
| Synonyms: | AC1O58BR;2-Propenoic acid, 2-methyl-, methyl ester, polymer with ethenol and2-propenenitrile;ethenol; methyl 2-methylprop-2-enoate; prop-2-enenitrile;2-Propenoic acid, 2-methyl-, methyl ester, polymer with ethenol and 2-propenenitrile;60092-21-9 |
| CAS: | 60092-21-9 |
| Molecular Formula: | C10H15NO3 |
| Molecular Weight: | 197.231 |
| InChI: | InChI=1S/C5H8O2.C3H3N.C2H4O/c1-4(2)5(6)7-3;1-2-3-4;1-2-3/h1H2,2-3H3;2H,1H2;2-3H,1H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 10°C |
| Boiling Point: | 100.3°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 10°C |
| Safety Data | |
 |
|
